Novel approach to benzo-fused 1,2-azaphospholene involving a Pd(ii)-assisted tandem P–C bond cleavage and P–N bond formation reaction†‡
Abstract
New bisphosphine o-Ph2PC6H4C(O)N(H)C6H4PPh2-o (1) (Bala-HariPhos) showed a unique reactivity towards Pd(II) resulting in a 1,2-azaphospholene complex, involving a tandem P–C bond cleavage, P–N bond formation and cyclization process via the elimination of PhH. Mechanistic details were investigated using NMR spectroscopy, DFT calculations and kinetic data, and by SCXRD analysis. It involves the reductive elimination from a tautomerised complex to form a phosphonium salt followed by oxidative addition.